C13H24N2O2S — CID 91456208
9-amino-6-methylidene-N-propylnona-2,4-diene-2-sulfonamide (PubChem CID 91456208) has the molecular formula C13H24N2O2S and a molecular weight of 272.41 g/mol. Its IUPAC name is 9-amino-6-methylidene-N-propylnona-2,4-diene-2-sulfonamide.
| Compound Name | 9-amino-6-methylidene-N-propylnona-2,4-diene-2-sulfonamide |
|---|---|
| PubChem CID | 91456208 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 9-amino-6-methylidene-N-propylnona-2,4-diene-2-sulfonamide |
| SMILES | C=C(C=CC=C(C)S(=O)(=O)NCCC)CCCN |
| InChI | InChI=1S/C13H24N2O2S/c1-4-11-15-18(16,17)13(3)9-5-7-12(2)8-6-10-14/h5,7,9,15H,2,4,6,8,10-11,14H2,1,3H3 |
| InChIKey | YIWQBUPDGKSKKJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|