C11H20N2OS — CID 143929667
(3E)-2-methyl-N-piperidin-4-ylpenta-1,3-diene-3-sulfinamide (PubChem CID 143929667) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is (3E)-2-methyl-N-piperidin-4-ylpenta-1,3-diene-3-sulfinamide.
| Compound Name | (3E)-2-methyl-N-piperidin-4-ylpenta-1,3-diene-3-sulfinamide |
|---|---|
| PubChem CID | 143929667 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (3E)-2-methyl-N-piperidin-4-ylpenta-1,3-diene-3-sulfinamide |
| SMILES | C=C(C)/C(=C\C)S(=O)NC1CCNCC1 |
| InChI | InChI=1S/C11H20N2OS/c1-4-11(9(2)3)15(14)13-10-5-7-12-8-6-10/h4,10,12-13H,2,5-8H2,1,3H3/b11-4+ |
| InChIKey | ISYATZKAZGGGSY-NYYWCZLTSA-N |
| XLogP | 1.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|