C10H16N2O2S — CID 71079553
1-cyclopenta-1,3-dien-1-ylsulfonylpiperidin-4-amine (PubChem CID 71079553) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-ylsulfonylpiperidin-4-amine.
| Compound Name | 1-cyclopenta-1,3-dien-1-ylsulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 71079553 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-ylsulfonylpiperidin-4-amine |
| SMILES | NC1CCN(S(=O)(=O)C2=CC=CC2)CC1 |
| InChI | InChI=1S/C10H16N2O2S/c11-9-5-7-12(8-6-9)15(13,14)10-3-1-2-4-10/h1-3,9H,4-8,11H2 |
| InChIKey | IBXIJMQTDOMJMP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |