C12H21N3O4S2 — CID 164863467
4-methyl-4-N-piperidin-4-ylcyclohexa-1,5-diene-1,4-disulfonamide (PubChem CID 164863467) has the molecular formula C12H21N3O4S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-methyl-4-N-piperidin-4-ylcyclohexa-1,5-diene-1,4-disulfonamide.
| Compound Name | 4-methyl-4-N-piperidin-4-ylcyclohexa-1,5-diene-1,4-disulfonamide |
|---|---|
| PubChem CID | 164863467 |
| Molecular Formula | C12H21N3O4S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 4-methyl-4-N-piperidin-4-ylcyclohexa-1,5-diene-1,4-disulfonamide |
| SMILES | CC1(S(=O)(=O)NC2CCNCC2)C=CC(S(N)(=O)=O)=CC1 |
| InChI | InChI=1S/C12H21N3O4S2/c1-12(6-2-11(3-7-12)20(13,16)17)21(18,19)15-10-4-8-14-9-5-10/h2-3,6,10,14-15H,4-5,7-9H2,1H3,(H2,13,16,17) |
| InChIKey | RGDGOIBTXXFCEW-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |