C11H20N2O2S — CID 91481326
2-methyl-N-piperidin-4-ylpenta-1,3-diene-3-sulfonamide (PubChem CID 91481326) has the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 2-methyl-N-piperidin-4-ylpenta-1,3-diene-3-sulfonamide.
| Compound Name | 2-methyl-N-piperidin-4-ylpenta-1,3-diene-3-sulfonamide |
|---|---|
| PubChem CID | 91481326 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 2-methyl-N-piperidin-4-ylpenta-1,3-diene-3-sulfonamide |
| SMILES | C=C(C)C(=CC)S(=O)(=O)NC1CCNCC1 |
| InChI | InChI=1S/C11H20N2O2S/c1-4-11(9(2)3)16(14,15)13-10-5-7-12-8-6-10/h4,10,12-13H,2,5-8H2,1,3H3 |
| InChIKey | HAWHACLAQRBGCP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|