C27H23F3N4O2 — CID 143184930
1-[3-(3-cyano-5-methoxy-1-propylindol-2-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 143184930) has the molecular formula C27H23F3N4O2 and a molecular weight of 492.50 g/mol. Its IUPAC name is 1-[3-(3-cyano-5-methoxy-1-propylindol-2-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-(3-cyano-5-methoxy-1-propylindol-2-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 143184930 |
| Molecular Formula | C27H23F3N4O2 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 1-[3-(3-cyano-5-methoxy-1-propylindol-2-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CCCn1c(-c2cccc(NC(=O)Nc3cccc(C(F)(F)F)c3)c2)c(C#N)c2cc(OC)ccc21 |
| InChI | InChI=1S/C27H23F3N4O2/c1-3-12-34-24-11-10-21(36-2)15-22(24)23(16-31)25(34)17-6-4-8-19(13-17)32-26(35)33-20-9-5-7-18(14-20)27(28,29)30/h4-11,13-15H,3,12H2,1-2H3,(H2,32,33,35) |
| InChIKey | PVUJFWBWNCOBCT-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |