C10H13NS — CID 143185910
6-ethyl-5-methyl-5,6-dihydrothieno[2,3-b]pyridine (PubChem CID 143185910) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 6-ethyl-5-methyl-5,6-dihydrothieno[2,3-b]pyridine.
| Compound Name | 6-ethyl-5-methyl-5,6-dihydrothieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 143185910 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 6-ethyl-5-methyl-5,6-dihydrothieno[2,3-b]pyridine |
| SMILES | CCC1N=c2sccc2=CC1C |
| InChI | InChI=1S/C10H13NS/c1-3-9-7(2)6-8-4-5-12-10(8)11-9/h4-7,9H,3H2,1-2H3 |
| InChIKey | JADHZBOBUQDUAI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |