C28H32N2O3 — CID 143186496
tert-butyl 13-cyclohexyl-10-formyl-6,7-dihydroindolo[1,2-d][1,4]benzodiazepine-5-carboxylate (PubChem CID 143186496) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is tert-butyl 13-cyclohexyl-10-formyl-6,7-dihydroindolo[1,2-d][1,4]benzodiazepine-5-carboxylate.
| Compound Name | tert-butyl 13-cyclohexyl-10-formyl-6,7-dihydroindolo[1,2-d][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 143186496 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | tert-butyl 13-cyclohexyl-10-formyl-6,7-dihydroindolo[1,2-d][1,4]benzodiazepine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCn2c(c(C3CCCCC3)c3ccc(C=O)cc32)-c2ccccc21 |
| InChI | InChI=1S/C28H32N2O3/c1-28(2,3)33-27(32)30-16-15-29-24-17-19(18-31)13-14-21(24)25(20-9-5-4-6-10-20)26(29)22-11-7-8-12-23(22)30/h7-8,11-14,17-18,20H,4-6,9-10,15-16H2,1-3H3 |
| InChIKey | PAPPQXWJGVCWHS-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|