C45H51N5O6 — CID 89337392
tert-butyl 13-cyclohexyl-10-[[1-[[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]carbamoyl]cyclopentyl]iminocarbamoyl]-6,7-dihydroindolo[1,2-d][1,4]benzodiazepine-5-carboxylate (PubChem CID 89337392) has the molecular formula C45H51N5O6 and a molecular weight of 757.93 g/mol. Its IUPAC name is tert-butyl 13-cyclohexyl-10-[[1-[[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]carbamoyl]cyclopentyl]iminocarbamoyl]-6,7-dihydroindolo[1,2-d][1,4]benzodiazepine-5-carboxylate.
| Compound Name | tert-butyl 13-cyclohexyl-10-[[1-[[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]carbamoyl]cyclopentyl]iminocarbamoyl]-6,7-dihydroindolo[1,2-d][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 89337392 |
| Molecular Formula | C45H51N5O6 |
| Molecular Weight | 757.93 g/mol |
| Exact Mass | 757.38 |
| IUPAC Name | tert-butyl 13-cyclohexyl-10-[[1-[[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]carbamoyl]cyclopentyl]iminocarbamoyl]-6,7-dihydroindolo[1,2-d][1,4]benzodiazepine-5-carboxylate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)C2(/N=N/C(=O)c3ccc4c(C5CCCCC5)c5n(c4c3)CCN(C(=O)OC(C)(C)C)c3ccccc3-5)CCCC2)cc1 |
| InChI | InChI=1S/C45H51N5O6/c1-5-55-38(51)24-19-30-17-21-33(22-18-30)46-42(53)45(25-11-12-26-45)48-47-41(52)32-20-23-34-37(29-32)49-27-28-50(43(54)56-44(2,3)4)36-16-10-9-15-35(36)40(49)39(34)31-13-7-6-8-14-31/h9-10,15-24,29,31H,5-8,11-14,25-28H2,1-4H3,(H,46,53)/b24-19+,48-47+ |
| InChIKey | ZQBPWTLNZILUFN-YHWKUMGGSA-N |
| XLogP | 10.23 |
| TPSA | 131.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.93 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|