C27H28F3N3O2 — CID 143187879
5-[(E)-1-[amino-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]amino]prop-1-en-2-yl]-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-one (PubChem CID 143187879) has the molecular formula C27H28F3N3O2 and a molecular weight of 483.53 g/mol. Its IUPAC name is 5-[(E)-1-[amino-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]amino]prop-1-en-2-yl]-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-one.
| Compound Name | 5-[(E)-1-[amino-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]amino]prop-1-en-2-yl]-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 143187879 |
| Molecular Formula | C27H28F3N3O2 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 5-[(E)-1-[amino-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]amino]prop-1-en-2-yl]-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-one |
| SMILES | C=C/C(=C\C=C/C)CN(N)/C=C(\C)c1ccc2c(c1)CN(Cc1ccc(OC(F)(F)F)cc1)C2=O |
| InChI | InChI=1S/C27H28F3N3O2/c1-4-6-7-20(5-2)17-33(31)15-19(3)22-10-13-25-23(14-22)18-32(26(25)34)16-21-8-11-24(12-9-21)35-27(28,29)30/h4-15H,2,16-18,31H2,1,3H3/b6-4-,19-15+,20-7+ |
| InChIKey | JTEPKZOERWXCCL-QAOHSVCSSA-N |
| XLogP | 5.97 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|