C23H25N3O4S — CID 87893854
2-[4-[2-(6-carbamothioyl-3-oxo-1H-isoindol-2-yl)acetyl]phenoxy]-2-ethylbutanamide (PubChem CID 87893854) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is 2-[4-[2-(6-carbamothioyl-3-oxo-1H-isoindol-2-yl)acetyl]phenoxy]-2-ethylbutanamide.
| Compound Name | 2-[4-[2-(6-carbamothioyl-3-oxo-1H-isoindol-2-yl)acetyl]phenoxy]-2-ethylbutanamide |
|---|---|
| PubChem CID | 87893854 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-[4-[2-(6-carbamothioyl-3-oxo-1H-isoindol-2-yl)acetyl]phenoxy]-2-ethylbutanamide |
| SMILES | CCC(CC)(Oc1ccc(C(=O)CN2Cc3cc(C(N)=S)ccc3C2=O)cc1)C(N)=O |
| InChI | InChI=1S/C23H25N3O4S/c1-3-23(4-2,22(25)29)30-17-8-5-14(6-9-17)19(27)13-26-12-16-11-15(20(24)31)7-10-18(16)21(26)28/h5-11H,3-4,12-13H2,1-2H3,(H2,24,31)(H2,25,29) |
| InChIKey | LYCFTFLIFXRUEC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|