C22H18FIO4 — CID 143190656
2-(4-fluorophenoxy)-4-[4-(2-iodoethoxy)-2-methylphenyl]benzoic acid (PubChem CID 143190656) has the molecular formula C22H18FIO4 and a molecular weight of 492.28 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-4-[4-(2-iodoethoxy)-2-methylphenyl]benzoic acid.
| Compound Name | 2-(4-fluorophenoxy)-4-[4-(2-iodoethoxy)-2-methylphenyl]benzoic acid |
|---|---|
| PubChem CID | 143190656 |
| Molecular Formula | C22H18FIO4 |
| Molecular Weight | 492.28 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | 2-(4-fluorophenoxy)-4-[4-(2-iodoethoxy)-2-methylphenyl]benzoic acid |
| SMILES | Cc1cc(OCCI)ccc1-c1ccc(C(=O)O)c(Oc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H18FIO4/c1-14-12-18(27-11-10-24)7-9-19(14)15-2-8-20(22(25)26)21(13-15)28-17-5-3-16(23)4-6-17/h2-9,12-13H,10-11H2,1H3,(H,25,26) |
| InChIKey | YBSDQDDLLIAFDO-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.28 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|