C27H32O4 — CID 142932454
4-(3,5-dimethyl-4-propoxyphenyl)-2-(4-methylphenoxy)benzoic acid;ethane (PubChem CID 142932454) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is 4-(3,5-dimethyl-4-propoxyphenyl)-2-(4-methylphenoxy)benzoic acid;ethane.
| Compound Name | 4-(3,5-dimethyl-4-propoxyphenyl)-2-(4-methylphenoxy)benzoic acid;ethane |
|---|---|
| PubChem CID | 142932454 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 4-(3,5-dimethyl-4-propoxyphenyl)-2-(4-methylphenoxy)benzoic acid;ethane |
| SMILES | CC.CCCOc1c(C)cc(-c2ccc(C(=O)O)c(Oc3ccc(C)cc3)c2)cc1C |
| InChI | InChI=1S/C25H26O4.C2H6/c1-5-12-28-24-17(3)13-20(14-18(24)4)19-8-11-22(25(26)27)23(15-19)29-21-9-6-16(2)7-10-21;1-2/h6-11,13-15H,5,12H2,1-4H3,(H,26,27);1-2H3 |
| InChIKey | STZLPDHZJPZQMI-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |