C31H47N7O — CID 143191656
[4-[2-(diethylamino)ethyl]piperazin-1-yl]-[2-[[ethyl-[(3R)-3-methyl-2,3,5,6,7,8-hexahydroquinolin-8-yl]amino]methyl]-3H-benzimidazol-5-yl]methanone (PubChem CID 143191656) has the molecular formula C31H47N7O and a molecular weight of 533.77 g/mol. Its IUPAC name is [4-[2-(diethylamino)ethyl]piperazin-1-yl]-[2-[[ethyl-[(3R)-3-methyl-2,3,5,6,7,8-hexahydroquinolin-8-yl]amino]methyl]-3H-benzimidazol-5-yl]methanone.
| Compound Name | [4-[2-(diethylamino)ethyl]piperazin-1-yl]-[2-[[ethyl-[(3R)-3-methyl-2,3,5,6,7,8-hexahydroquinolin-8-yl]amino]methyl]-3H-benzimidazol-5-yl]methanone |
|---|---|
| PubChem CID | 143191656 |
| Molecular Formula | C31H47N7O |
| Molecular Weight | 533.77 g/mol |
| Exact Mass | 533.38 |
| IUPAC Name | [4-[2-(diethylamino)ethyl]piperazin-1-yl]-[2-[[ethyl-[(3R)-3-methyl-2,3,5,6,7,8-hexahydroquinolin-8-yl]amino]methyl]-3H-benzimidazol-5-yl]methanone |
| SMILES | CCN(CC)CCN1CCN(C(=O)c2ccc3nc(CN(CC)C4CCCC5=C[C@@H](C)CN=C54)[nH]c3c2)CC1 |
| InChI | InChI=1S/C31H47N7O/c1-5-35(6-2)13-14-36-15-17-38(18-16-36)31(39)25-11-12-26-27(20-25)34-29(33-26)22-37(7-3)28-10-8-9-24-19-23(4)21-32-30(24)28/h11-12,19-20,23,28H,5-10,13-18,21-22H2,1-4H3,(H,33,34)/t23-,28?/m1/s1 |
| InChIKey | HUFVIDCMYDCCMO-YFIOFSHDSA-N |
| XLogP | 4.05 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.77 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |