C10H15NO — CID 143195760
(2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylidenemorpholine (PubChem CID 143195760) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylidenemorpholine.
| Compound Name | (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylidenemorpholine |
|---|---|
| PubChem CID | 143195760 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylidenemorpholine |
| SMILES | C/C=C\C=C1\NCCO\C1=C\C |
| InChI | InChI=1S/C10H15NO/c1-3-5-6-9-10(4-2)12-8-7-11-9/h3-6,11H,7-8H2,1-2H3/b5-3-,9-6+,10-4+ |
| InChIKey | WCHHJOFNEOTAEN-XBQWZGCMSA-N |
| XLogP | 1.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |