C19H24N4O4 — CID 143198839
(E)-1-(2-amino-4,5-dimethoxyphenyl)-N-(4-nitrophenyl)-N-propylethene-1,2-diamine (PubChem CID 143198839) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is (E)-1-(2-amino-4,5-dimethoxyphenyl)-N-(4-nitrophenyl)-N-propylethene-1,2-diamine.
| Compound Name | (E)-1-(2-amino-4,5-dimethoxyphenyl)-N-(4-nitrophenyl)-N-propylethene-1,2-diamine |
|---|---|
| PubChem CID | 143198839 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (E)-1-(2-amino-4,5-dimethoxyphenyl)-N-(4-nitrophenyl)-N-propylethene-1,2-diamine |
| SMILES | CCCN(/C(=C/N)c1cc(OC)c(OC)cc1N)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H24N4O4/c1-4-9-22(13-5-7-14(8-6-13)23(24)25)17(12-20)15-10-18(26-2)19(27-3)11-16(15)21/h5-8,10-12H,4,9,20-21H2,1-3H3/b17-12+ |
| InChIKey | ZQRHLWASOQDORI-SFQUDFHCSA-N |
| XLogP | 3.37 |
| TPSA | 116.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|