C22H28N2O2 — CID 143198999
(E)-3-(3,5-dimethoxyphenyl)-3-[3-methyl-4-(methylamino)phenyl]prop-2-enenitrile;propane (PubChem CID 143198999) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-3-[3-methyl-4-(methylamino)phenyl]prop-2-enenitrile;propane.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-3-[3-methyl-4-(methylamino)phenyl]prop-2-enenitrile;propane |
|---|---|
| PubChem CID | 143198999 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-3-[3-methyl-4-(methylamino)phenyl]prop-2-enenitrile;propane |
| SMILES | CCC.CNc1ccc(/C(=C\C#N)c2cc(OC)cc(OC)c2)cc1C |
| InChI | InChI=1S/C19H20N2O2.C3H8/c1-13-9-14(5-6-19(13)21-2)18(7-8-20)15-10-16(22-3)12-17(11-15)23-4;1-3-2/h5-7,9-12,21H,1-4H3;3H2,1-2H3/b18-7+; |
| InChIKey | BMIKLGLCEBWHKS-CWSPIBBISA-N |
| XLogP | 5.43 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|