C25H29N3O6 — CID 69202427
tert-butyl N-(2-aminoacetyl)-N-[5-[(Z)-2-cyano-1-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]carbamate (PubChem CID 69202427) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is tert-butyl N-(2-aminoacetyl)-N-[5-[(Z)-2-cyano-1-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-(2-aminoacetyl)-N-[5-[(Z)-2-cyano-1-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 69202427 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | tert-butyl N-(2-aminoacetyl)-N-[5-[(Z)-2-cyano-1-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]carbamate |
| SMILES | COc1cc(OC)cc(/C(=C\C#N)c2ccc(OC)c(N(C(=O)CN)C(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C25H29N3O6/c1-25(2,3)34-24(30)28(23(29)15-27)21-13-16(7-8-22(21)33-6)20(9-10-26)17-11-18(31-4)14-19(12-17)32-5/h7-9,11-14H,15,27H2,1-6H3/b20-9- |
| InChIKey | ZYJCFSHCOUCBDE-UKWGHVSLSA-N |
| XLogP | 3.89 |
| TPSA | 124.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|