C22H31N5O4 — CID 143199257
2-[4-[2-[4-butanimidoyl-2-ethyl-5-(methylamino)-6-oxopyrimidin-1-yl]ethoxy]anilino]propanoic acid (PubChem CID 143199257) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-[4-[2-[4-butanimidoyl-2-ethyl-5-(methylamino)-6-oxopyrimidin-1-yl]ethoxy]anilino]propanoic acid.
| Compound Name | 2-[4-[2-[4-butanimidoyl-2-ethyl-5-(methylamino)-6-oxopyrimidin-1-yl]ethoxy]anilino]propanoic acid |
|---|---|
| PubChem CID | 143199257 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-[4-[2-[4-butanimidoyl-2-ethyl-5-(methylamino)-6-oxopyrimidin-1-yl]ethoxy]anilino]propanoic acid |
| SMILES | [H]/N=C(\CCC)c1nc(CC)n(CCOc2ccc(NC(C)C(=O)O)cc2)c(=O)c1NC |
| InChI | InChI=1S/C22H31N5O4/c1-5-7-17(23)19-20(24-4)21(28)27(18(6-2)26-19)12-13-31-16-10-8-15(9-11-16)25-14(3)22(29)30/h8-11,14,23-25H,5-7,12-13H2,1-4H3,(H,29,30)/b23-17+ |
| InChIKey | BAWFPAATABFEBK-HAVVHWLPSA-N |
| XLogP | 2.98 |
| TPSA | 129.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|