C16H24O6 — CID 143201092
2-(2-ethoxy-2-methylpropanoyl)cyclopentane-1,3-dione;ethyl prop-2-enoate (PubChem CID 143201092) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is 2-(2-ethoxy-2-methylpropanoyl)cyclopentane-1,3-dione;ethyl prop-2-enoate.
| Compound Name | 2-(2-ethoxy-2-methylpropanoyl)cyclopentane-1,3-dione;ethyl prop-2-enoate |
|---|---|
| PubChem CID | 143201092 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-(2-ethoxy-2-methylpropanoyl)cyclopentane-1,3-dione;ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCC.CCOC(C)(C)C(=O)C1C(=O)CCC1=O |
| InChI | InChI=1S/C11H16O4.C5H8O2/c1-4-15-11(2,3)10(14)9-7(12)5-6-8(9)13;1-3-5(6)7-4-2/h9H,4-6H2,1-3H3;3H,1,4H2,2H3 |
| InChIKey | SXHVMWRPAMGLDE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|