C16H26O5 — CID 161059696
butan-2-one;ethyl prop-2-enoate;4-methylcyclohexane-1,3-dione (PubChem CID 161059696) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is butan-2-one;ethyl prop-2-enoate;4-methylcyclohexane-1,3-dione.
| Compound Name | butan-2-one;ethyl prop-2-enoate;4-methylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 161059696 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | butan-2-one;ethyl prop-2-enoate;4-methylcyclohexane-1,3-dione |
| SMILES | C=CC(=O)OCC.CC1CCC(=O)CC1=O.CCC(C)=O |
| InChI | InChI=1S/C7H10O2.C5H8O2.C4H8O/c1-5-2-3-6(8)4-7(5)9;1-3-5(6)7-4-2;1-3-4(2)5/h5H,2-4H2,1H3;3H,1,4H2,2H3;3H2,1-2H3 |
| InChIKey | UDFTXECURQZAOP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|