C9H16O2 — CID 153395482
ethane;4-methylcyclohexane-1,3-dione (PubChem CID 153395482) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is ethane;4-methylcyclohexane-1,3-dione.
| Compound Name | ethane;4-methylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 153395482 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | ethane;4-methylcyclohexane-1,3-dione |
| SMILES | CC.CC1CCC(=O)CC1=O |
| InChI | InChI=1S/C7H10O2.C2H6/c1-5-2-3-6(8)4-7(5)9;1-2/h5H,2-4H2,1H3;1-2H3 |
| InChIKey | PTQMDBRFHCBFGT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|