C26H37N5O4 — CID 143201540
4-[2-(dimethylamino)ethylamino]-7-[2-(dimethylamino)ethyl-[2-(methylamino)ethyl]amino]-12,15-dihydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2,9-dione (PubChem CID 143201540) has the molecular formula C26H37N5O4 and a molecular weight of 483.61 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethylamino]-7-[2-(dimethylamino)ethyl-[2-(methylamino)ethyl]amino]-12,15-dihydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2,9-dione.
| Compound Name | 4-[2-(dimethylamino)ethylamino]-7-[2-(dimethylamino)ethyl-[2-(methylamino)ethyl]amino]-12,15-dihydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2,9-dione |
|---|---|
| PubChem CID | 143201540 |
| Molecular Formula | C26H37N5O4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | 4-[2-(dimethylamino)ethylamino]-7-[2-(dimethylamino)ethyl-[2-(methylamino)ethyl]amino]-12,15-dihydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2,9-dione |
| SMILES | CNCCN(CCN(C)C)c1ccc(NCCN(C)C)c2c1C(=O)Cc1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C26H37N5O4/c1-27-10-13-31(15-14-30(4)5)19-7-6-18(28-11-12-29(2)3)24-25(19)22(34)16-17-20(32)8-9-21(33)23(17)26(24)35/h6-9,27-28,32-33H,10-16H2,1-5H3 |
| InChIKey | OOVCBLJMGFEJNC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|