C8H10F3NO — CID 143206173
(3Z)-N-methyl-5-(trifluoromethoxy)hexa-1,3,5-trien-2-amine (PubChem CID 143206173) has the molecular formula C8H10F3NO and a molecular weight of 193.17 g/mol. Its IUPAC name is (3Z)-N-methyl-5-(trifluoromethoxy)hexa-1,3,5-trien-2-amine.
| Compound Name | (3Z)-N-methyl-5-(trifluoromethoxy)hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143206173 |
| Molecular Formula | C8H10F3NO |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (3Z)-N-methyl-5-(trifluoromethoxy)hexa-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(=C)OC(F)(F)F)NC |
| InChI | InChI=1S/C8H10F3NO/c1-6(12-3)4-5-7(2)13-8(9,10)11/h4-5,12H,1-2H2,3H3/b5-4- |
| InChIKey | PRAXLFKGUWXQQG-PLNGDYQASA-N |
| XLogP | 2.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|