C9H12F3NO — CID 143206141
(3Z,5E)-N-methyl-5-(trifluoromethoxy)hepta-1,3,5-trien-2-amine (PubChem CID 143206141) has the molecular formula C9H12F3NO and a molecular weight of 207.19 g/mol. Its IUPAC name is (3Z,5E)-N-methyl-5-(trifluoromethoxy)hepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5E)-N-methyl-5-(trifluoromethoxy)hepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143206141 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (3Z,5E)-N-methyl-5-(trifluoromethoxy)hepta-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(=C/C)OC(F)(F)F)NC |
| InChI | InChI=1S/C9H12F3NO/c1-4-8(14-9(10,11)12)6-5-7(2)13-3/h4-6,13H,2H2,1,3H3/b6-5-,8-4+ |
| InChIKey | WDNCWOOZZLNXHZ-QNMAEOQASA-N |
| XLogP | 2.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|