C19H36N2 — CID 143207301
ethane;(5Z,7Z)-2-methyl-5-(1-piperidin-1-ylethenyl)nona-5,7-dien-4-amine (PubChem CID 143207301) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is ethane;(5Z,7Z)-2-methyl-5-(1-piperidin-1-ylethenyl)nona-5,7-dien-4-amine.
| Compound Name | ethane;(5Z,7Z)-2-methyl-5-(1-piperidin-1-ylethenyl)nona-5,7-dien-4-amine |
|---|---|
| PubChem CID | 143207301 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | ethane;(5Z,7Z)-2-methyl-5-(1-piperidin-1-ylethenyl)nona-5,7-dien-4-amine |
| SMILES | C=C(/C(=C\C=C/C)C(N)CC(C)C)N1CCCCC1.CC |
| InChI | InChI=1S/C17H30N2.C2H6/c1-5-6-10-16(17(18)13-14(2)3)15(4)19-11-8-7-9-12-19;1-2/h5-6,10,14,17H,4,7-9,11-13,18H2,1-3H3;1-2H3/b6-5-,16-10+; |
| InChIKey | LYIRQNCOBDXDIJ-LVMQOWHJSA-N |
| XLogP | 4.89 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|