C21H14ClF4N5O — CID 143211399
1-[4-[(4-chloroimidazo[4,5-c]pyridin-3-yl)methyl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea (PubChem CID 143211399) has the molecular formula C21H14ClF4N5O and a molecular weight of 463.82 g/mol. Its IUPAC name is 1-[4-[(4-chloroimidazo[4,5-c]pyridin-3-yl)methyl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[(4-chloroimidazo[4,5-c]pyridin-3-yl)methyl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 143211399 |
| Molecular Formula | C21H14ClF4N5O |
| Molecular Weight | 463.82 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 1-[4-[(4-chloroimidazo[4,5-c]pyridin-3-yl)methyl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cn2cnc3ccnc(Cl)c32)cc1)Nc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C21H14ClF4N5O/c22-19-18-16(7-8-27-19)28-11-31(18)10-12-1-4-14(5-2-12)29-20(32)30-17-9-13(21(24,25)26)3-6-15(17)23/h1-9,11H,10H2,(H2,29,30,32) |
| InChIKey | PZEHWGYCNQDIES-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.82 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|