C24H23FN2O3 — CID 143212421
ethyl 5-(2-amino-5-fluorophenyl)-2-[[3,4-bis(ethenyl)benzoyl]amino]pent-4-ynoate (PubChem CID 143212421) has the molecular formula C24H23FN2O3 and a molecular weight of 406.46 g/mol. Its IUPAC name is ethyl 5-(2-amino-5-fluorophenyl)-2-[[3,4-bis(ethenyl)benzoyl]amino]pent-4-ynoate.
| Compound Name | ethyl 5-(2-amino-5-fluorophenyl)-2-[[3,4-bis(ethenyl)benzoyl]amino]pent-4-ynoate |
|---|---|
| PubChem CID | 143212421 |
| Molecular Formula | C24H23FN2O3 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | ethyl 5-(2-amino-5-fluorophenyl)-2-[[3,4-bis(ethenyl)benzoyl]amino]pent-4-ynoate |
| SMILES | C=Cc1ccc(C(=O)NC(CC#Cc2cc(F)ccc2N)C(=O)OCC)cc1C=C |
| InChI | InChI=1S/C24H23FN2O3/c1-4-16-10-11-19(14-17(16)5-2)23(28)27-22(24(29)30-6-3)9-7-8-18-15-20(25)12-13-21(18)26/h4-5,10-15,22H,1-2,6,9,26H2,3H3,(H,27,28) |
| InChIKey | AKEUKNCHFIMYBN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|