C21H35NO2 — CID 143215085
tert-butyl 3-[(3E)-hexa-1,3,5-trien-2-yl]-3-methylazepane-1-carboxylate;prop-1-ene (PubChem CID 143215085) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is tert-butyl 3-[(3E)-hexa-1,3,5-trien-2-yl]-3-methylazepane-1-carboxylate;prop-1-ene.
| Compound Name | tert-butyl 3-[(3E)-hexa-1,3,5-trien-2-yl]-3-methylazepane-1-carboxylate;prop-1-ene |
|---|---|
| PubChem CID | 143215085 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | tert-butyl 3-[(3E)-hexa-1,3,5-trien-2-yl]-3-methylazepane-1-carboxylate;prop-1-ene |
| SMILES | C=C/C=C/C(=C)C1(C)CCCCN(C(=O)OC(C)(C)C)C1.C=CC |
| InChI | InChI=1S/C18H29NO2.C3H6/c1-7-8-11-15(2)18(6)12-9-10-13-19(14-18)16(20)21-17(3,4)5;1-3-2/h7-8,11H,1-2,9-10,12-14H2,3-6H3;3H,1H2,2H3/b11-8+; |
| InChIKey | HYAONIKKJPRRMB-YGCVIUNWSA-N |
| XLogP | 5.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|