C31H45ClFN3O4 — CID 143215215
(3R)-N-[(2R,3S)-2-amino-3-hydroxy-4-(2-tetracyclo[3.3.1.01,3.02,7]nonanyl)butyl]-3-[(1S)-1-(3-chloro-2-fluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxamide (PubChem CID 143215215) has the molecular formula C31H45ClFN3O4 and a molecular weight of 578.17 g/mol. Its IUPAC name is (3R)-N-[(2R,3S)-2-amino-3-hydroxy-4-(2-tetracyclo[3.3.1.01,3.02,7]nonanyl)butyl]-3-[(1S)-1-(3-chloro-2-fluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxamide.
| Compound Name | (3R)-N-[(2R,3S)-2-amino-3-hydroxy-4-(2-tetracyclo[3.3.1.01,3.02,7]nonanyl)butyl]-3-[(1S)-1-(3-chloro-2-fluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 143215215 |
| Molecular Formula | C31H45ClFN3O4 |
| Molecular Weight | 578.17 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | (3R)-N-[(2R,3S)-2-amino-3-hydroxy-4-(2-tetracyclo[3.3.1.01,3.02,7]nonanyl)butyl]-3-[(1S)-1-(3-chloro-2-fluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxamide |
| SMILES | COCCCC[C@@](O)(c1cccc(Cl)c1F)[C@@H]1CCCN(C(=O)NC[C@@H](N)[C@@H](O)CC23C4CC5CC2C3(C5)C4)C1 |
| InChI | InChI=1S/C31H45ClFN3O4/c1-40-11-3-2-9-31(39,22-7-4-8-23(32)27(22)33)20-6-5-10-36(18-20)28(38)35-17-24(34)25(37)16-30-21-12-19-13-26(30)29(30,14-19)15-21/h4,7-8,19-21,24-26,37,39H,2-3,5-6,9-18,34H2,1H3,(H,35,38)/t19?,20-,21?,24-,25+,26?,29?,30?,31+/m1/s1 |
| InChIKey | AVWWBEYRXLXPNA-JCNCKNPNSA-N |
| XLogP | 4.42 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.17 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|