C13H24N2 — CID 143216266
4,5-dimethyl-2,3-dihydro-1H-pyrrole;5,6-dimethyl-1,2,3,4-tetrahydropyridine (PubChem CID 143216266) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 4,5-dimethyl-2,3-dihydro-1H-pyrrole;5,6-dimethyl-1,2,3,4-tetrahydropyridine.
| Compound Name | 4,5-dimethyl-2,3-dihydro-1H-pyrrole;5,6-dimethyl-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 143216266 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 4,5-dimethyl-2,3-dihydro-1H-pyrrole;5,6-dimethyl-1,2,3,4-tetrahydropyridine |
| SMILES | CC1=C(C)NCC1.CC1=C(C)NCCC1 |
| InChI | InChI=1S/C7H13N.C6H11N/c1-6-4-3-5-8-7(6)2;1-5-3-4-7-6(5)2/h8H,3-5H2,1-2H3;7H,3-4H2,1-2H3 |
| InChIKey | HQYCOWJGYOORIX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |