C15H22N2 — CID 143216483
N-[(2Z,4Z)-hexa-2,4-dienyl]-1-methyl-N-prop-2-enyl-2H-pyridin-6-amine (PubChem CID 143216483) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is N-[(2Z,4Z)-hexa-2,4-dienyl]-1-methyl-N-prop-2-enyl-2H-pyridin-6-amine.
| Compound Name | N-[(2Z,4Z)-hexa-2,4-dienyl]-1-methyl-N-prop-2-enyl-2H-pyridin-6-amine |
|---|---|
| PubChem CID | 143216483 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N-[(2Z,4Z)-hexa-2,4-dienyl]-1-methyl-N-prop-2-enyl-2H-pyridin-6-amine |
| SMILES | C=CCN(C/C=C\C=C/C)C1=CC=CCN1C |
| InChI | InChI=1S/C15H22N2/c1-4-6-7-9-14-17(12-5-2)15-11-8-10-13-16(15)3/h4-11H,2,12-14H2,1,3H3/b6-4-,9-7- |
| InChIKey | OACHHCXYTJZSMR-PJPBHMPJSA-N |
| XLogP | 2.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|