C22H32F3N9O2 — CID 143221071
6-(3-ethoxypropanimidoyl)-2-[(3R)-3-methylpiperazin-1-yl]-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine (PubChem CID 143221071) has the molecular formula C22H32F3N9O2 and a molecular weight of 511.55 g/mol. Its IUPAC name is 6-(3-ethoxypropanimidoyl)-2-[(3R)-3-methylpiperazin-1-yl]-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine.
| Compound Name | 6-(3-ethoxypropanimidoyl)-2-[(3R)-3-methylpiperazin-1-yl]-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 143221071 |
| Molecular Formula | C22H32F3N9O2 |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 6-(3-ethoxypropanimidoyl)-2-[(3R)-3-methylpiperazin-1-yl]-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine |
| SMILES | [H]/N=C(\CCOCC)c1nc(N2CCN[C@H](C)C2)nc(Nc2ccncn2)c1NCCOCC(F)(F)F |
| InChI | InChI=1S/C22H32F3N9O2/c1-3-35-10-5-16(26)18-19(29-8-11-36-13-22(23,24)25)20(31-17-4-6-27-14-30-17)33-21(32-18)34-9-7-28-15(2)12-34/h4,6,14-15,26,28-29H,3,5,7-13H2,1-2H3,(H,27,30,31,32,33)/b26-16+/t15-/m1/s1 |
| InChIKey | AEOIQZGFBDBLRJ-SXJXFNOXSA-N |
| XLogP | 2.59 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|