C28H22F2N4O3S — CID 143222811
5-N-[6-ethanimidoyl-2-fluoro-3-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]phenyl]-1,2-benzoxazole-3,5-diamine (PubChem CID 143222811) has the molecular formula C28H22F2N4O3S and a molecular weight of 532.57 g/mol. Its IUPAC name is 5-N-[6-ethanimidoyl-2-fluoro-3-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]phenyl]-1,2-benzoxazole-3,5-diamine.
| Compound Name | 5-N-[6-ethanimidoyl-2-fluoro-3-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]phenyl]-1,2-benzoxazole-3,5-diamine |
|---|---|
| PubChem CID | 143222811 |
| Molecular Formula | C28H22F2N4O3S |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 5-N-[6-ethanimidoyl-2-fluoro-3-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]phenyl]-1,2-benzoxazole-3,5-diamine |
| SMILES | [H]/N=C(/C)c1ccc(-c2ccc(-c3ccccc3S(C)(=O)=O)cc2F)c(F)c1Nc1ccc2onc(N)c2c1 |
| InChI | InChI=1S/C28H22F2N4O3S/c1-15(31)18-10-11-21(26(30)27(18)33-17-8-12-24-22(14-17)28(32)34-37-24)20-9-7-16(13-23(20)29)19-5-3-4-6-25(19)38(2,35)36/h3-14,31,33H,1-2H3,(H2,32,34)/b31-15- |
| InChIKey | UFMUJLMWSNLWJA-BVMLUPFRSA-N |
| XLogP | 6.56 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|