C25H37N2O8P — CID 143223492
[(E)-4-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enyl]-N-[(2S)-1-(3-morpholin-4-ylpropoxy)-1-oxopropan-2-yl]phosphonamidous acid (PubChem CID 143223492) has the molecular formula C25H37N2O8P and a molecular weight of 524.55 g/mol. Its IUPAC name is [(E)-4-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enyl]-N-[(2S)-1-(3-morpholin-4-ylpropoxy)-1-oxopropan-2-yl]phosphonamidous acid.
| Compound Name | [(E)-4-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enyl]-N-[(2S)-1-(3-morpholin-4-ylpropoxy)-1-oxopropan-2-yl]phosphonamidous acid |
|---|---|
| PubChem CID | 143223492 |
| Molecular Formula | C25H37N2O8P |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | [(E)-4-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enyl]-N-[(2S)-1-(3-morpholin-4-ylpropoxy)-1-oxopropan-2-yl]phosphonamidous acid |
| SMILES | COc1c(C)c2c(c(O)c1C/C=C(\C)CP(O)N[C@@H](C)C(=O)OCCCN1CCOCC1)C(=O)OC2 |
| InChI | InChI=1S/C25H37N2O8P/c1-16(6-7-19-22(28)21-20(14-35-25(21)30)17(2)23(19)32-4)15-36(31)26-18(3)24(29)34-11-5-8-27-9-12-33-13-10-27/h6,18,26,28,31H,5,7-15H2,1-4H3/b16-6+/t18-,36?/m0/s1 |
| InChIKey | HIMGHGBNURIGEF-TZLQFXJTSA-N |
| XLogP | 2.42 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|