C11H12FN — CID 143224007
7-[(1Z)-buta-1,3-dienyl]-3-fluoro-2-methyl-4H-azepine (PubChem CID 143224007) has the molecular formula C11H12FN and a molecular weight of 177.22 g/mol. Its IUPAC name is 7-[(1Z)-buta-1,3-dienyl]-3-fluoro-2-methyl-4H-azepine.
| Compound Name | 7-[(1Z)-buta-1,3-dienyl]-3-fluoro-2-methyl-4H-azepine |
|---|---|
| PubChem CID | 143224007 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 7-[(1Z)-buta-1,3-dienyl]-3-fluoro-2-methyl-4H-azepine |
| SMILES | C=C/C=C\C1=NC(C)=C(F)CC=C1 |
| InChI | InChI=1S/C11H12FN/c1-3-4-6-10-7-5-8-11(12)9(2)13-10/h3-7H,1,8H2,2H3/b6-4- |
| InChIKey | RMDFAEWSIGIIIY-XQRVVYSFSA-N |
| XLogP | 3.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|