C25H25FN6 — CID 143226542
7-[2-(4-benzylpiperazin-1-yl)-6-fluorophenyl]quinazoline-2,4-diamine (PubChem CID 143226542) has the molecular formula C25H25FN6 and a molecular weight of 428.52 g/mol. Its IUPAC name is 7-[2-(4-benzylpiperazin-1-yl)-6-fluorophenyl]quinazoline-2,4-diamine.
| Compound Name | 7-[2-(4-benzylpiperazin-1-yl)-6-fluorophenyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 143226542 |
| Molecular Formula | C25H25FN6 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 7-[2-(4-benzylpiperazin-1-yl)-6-fluorophenyl]quinazoline-2,4-diamine |
| SMILES | Nc1nc(N)c2ccc(-c3c(F)cccc3N3CCN(Cc4ccccc4)CC3)cc2n1 |
| InChI | InChI=1S/C25H25FN6/c26-20-7-4-8-22(32-13-11-31(12-14-32)16-17-5-2-1-3-6-17)23(20)18-9-10-19-21(15-18)29-25(28)30-24(19)27/h1-10,15H,11-14,16H2,(H4,27,28,29,30) |
| InChIKey | WRWGNAMAHMSFMP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |