C22H19N3O2 — CID 143229213
N-(3-benzamidophenyl)-2,3-dihydro-1H-indole-6-carboxamide (PubChem CID 143229213) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-(3-benzamidophenyl)-2,3-dihydro-1H-indole-6-carboxamide.
| Compound Name | N-(3-benzamidophenyl)-2,3-dihydro-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 143229213 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-(3-benzamidophenyl)-2,3-dihydro-1H-indole-6-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2ccc3c(c2)NCC3)c1)c1ccccc1 |
| InChI | InChI=1S/C22H19N3O2/c26-21(16-5-2-1-3-6-16)24-18-7-4-8-19(14-18)25-22(27)17-10-9-15-11-12-23-20(15)13-17/h1-10,13-14,23H,11-12H2,(H,24,26)(H,25,27) |
| InChIKey | QPZMWVKLIPPDFF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |