C10H15NO — CID 143229970
3,6-dihydro-2H-cyclohepta[d][1,3]oxazole;ethane (PubChem CID 143229970) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 3,6-dihydro-2H-cyclohepta[d][1,3]oxazole;ethane.
| Compound Name | 3,6-dihydro-2H-cyclohepta[d][1,3]oxazole;ethane |
|---|---|
| PubChem CID | 143229970 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 3,6-dihydro-2H-cyclohepta[d][1,3]oxazole;ethane |
| SMILES | C1=CC2=C(C=CC1)OCN2.CC |
| InChI | InChI=1S/C8H9NO.C2H6/c1-2-4-7-8(5-3-1)10-6-9-7;1-2/h2-5,9H,1,6H2;1-2H3 |
| InChIKey | HPRMRJMFUUPRCP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |