About 4-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole
4-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole (PubChem CID 139460781) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 4-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole.
Analyze 4-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole?
The IUPAC name of 4-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole (CID 139460781) is 4-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole.
What is the SMILES notation for 4-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole?
The canonical SMILES for 4-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole is C=CC1=C(/C=C\C)OCN1.
What is the InChIKey of 4-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole?
The InChIKey is SYCFIDSRHRIWAZ-HYXAFXHYSA-N. The full InChI is InChI=1S/C8H11NO/c1-3-5-8-7(4-2)9-6-10-8/h3-5,9H,2,6H2,1H3/b5-3-.
What are the key properties of 4-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole?
4-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole has a molecular weight of 137.18 g/mol, XLogP of 1.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole is sourced from PubChem (CID 139460781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).