C31H42FN3O4 — CID 143231492
ethane;1-[6-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-7-methoxy-1,5-dihydrocyclohepta[b]pyrrol-3-yl]propane-1,2-dione (PubChem CID 143231492) has the molecular formula C31H42FN3O4 and a molecular weight of 539.69 g/mol. Its IUPAC name is ethane;1-[6-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-7-methoxy-1,5-dihydrocyclohepta[b]pyrrol-3-yl]propane-1,2-dione.
| Compound Name | ethane;1-[6-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-7-methoxy-1,5-dihydrocyclohepta[b]pyrrol-3-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 143231492 |
| Molecular Formula | C31H42FN3O4 |
| Molecular Weight | 539.69 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | ethane;1-[6-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-7-methoxy-1,5-dihydrocyclohepta[b]pyrrol-3-yl]propane-1,2-dione |
| SMILES | CC.CC.COC1=C(C(=O)N2CC(C)N(Cc3ccc(F)cc3)CC2C)CC=c2c(C(=O)C(C)=O)c[nH]c2=C1 |
| InChI | InChI=1S/C27H30FN3O4.2C2H6/c1-16-14-31(17(2)13-30(16)15-19-5-7-20(28)8-6-19)27(34)22-10-9-21-23(26(33)18(3)32)12-29-24(21)11-25(22)35-4;2*1-2/h5-9,11-12,16-17,29H,10,13-15H2,1-4H3;2*1-2H3 |
| InChIKey | MIXQOKWTEAVJDR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.69 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|