C23H42S — CID 143231657
2,2-dimethylpropane;ethene;heptyl-dimethylidene-(4-methylphenyl)-λ6-sulfane (PubChem CID 143231657) has the molecular formula C23H42S and a molecular weight of 350.66 g/mol. Its IUPAC name is 2,2-dimethylpropane;ethene;heptyl-dimethylidene-(4-methylphenyl)-λ6-sulfane.
| Compound Name | 2,2-dimethylpropane;ethene;heptyl-dimethylidene-(4-methylphenyl)-λ6-sulfane |
|---|---|
| PubChem CID | 143231657 |
| Molecular Formula | C23H42S |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | 2,2-dimethylpropane;ethene;heptyl-dimethylidene-(4-methylphenyl)-λ6-sulfane |
| SMILES | C=C.C=S(=C)(CCCCCCC)c1ccc(C)cc1.CC(C)(C)C |
| InChI | InChI=1S/C16H26S.C5H12.C2H4/c1-5-6-7-8-9-14-17(3,4)16-12-10-15(2)11-13-16;1-5(2,3)4;1-2/h10-13H,3-9,14H2,1-2H3;1-4H3;1-2H2 |
| InChIKey | MPPTWJPJAHBSAT-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|