C24H28N6O3 — CID 143235518
2-N-[4-[2-[(2-methylpropan-2-yl)oxy]ethylamino]phenyl]-3-N-(5-methyl-2-pyridinyl)pyrazine-2,3-dicarboxamide (PubChem CID 143235518) has the molecular formula C24H28N6O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is 2-N-[4-[2-[(2-methylpropan-2-yl)oxy]ethylamino]phenyl]-3-N-(5-methyl-2-pyridinyl)pyrazine-2,3-dicarboxamide.
| Compound Name | 2-N-[4-[2-[(2-methylpropan-2-yl)oxy]ethylamino]phenyl]-3-N-(5-methyl-2-pyridinyl)pyrazine-2,3-dicarboxamide |
|---|---|
| PubChem CID | 143235518 |
| Molecular Formula | C24H28N6O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 2-N-[4-[2-[(2-methylpropan-2-yl)oxy]ethylamino]phenyl]-3-N-(5-methyl-2-pyridinyl)pyrazine-2,3-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2nccnc2C(=O)Nc2ccc(NCCOC(C)(C)C)cc2)nc1 |
| InChI | InChI=1S/C24H28N6O3/c1-16-5-10-19(28-15-16)30-23(32)21-20(26-11-12-27-21)22(31)29-18-8-6-17(7-9-18)25-13-14-33-24(2,3)4/h5-12,15,25H,13-14H2,1-4H3,(H,29,31)(H,28,30,32) |
| InChIKey | GYBOAVCEVKPMEO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 118.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|