C12H16INO2 — CID 143235637
1-[(3,4-dimethoxyphenyl)methyl]-N-iodocyclopropan-1-amine (PubChem CID 143235637) has the molecular formula C12H16INO2 and a molecular weight of 333.17 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-N-iodocyclopropan-1-amine.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-N-iodocyclopropan-1-amine |
|---|---|
| PubChem CID | 143235637 |
| Molecular Formula | C12H16INO2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-N-iodocyclopropan-1-amine |
| SMILES | COc1ccc(CC2(NI)CC2)cc1OC |
| InChI | InChI=1S/C12H16INO2/c1-15-10-4-3-9(7-11(10)16-2)8-12(14-13)5-6-12/h3-4,7,14H,5-6,8H2,1-2H3 |
| InChIKey | UKUVTXNOVLJCCD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|