C18H19N3O3S — CID 143236031
2-amino-3-[3-[[C-(benzenecarboximidoyloxy)carbonimidoyl]sulfanylmethyl]phenyl]propanoic acid (PubChem CID 143236031) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 2-amino-3-[3-[[C-(benzenecarboximidoyloxy)carbonimidoyl]sulfanylmethyl]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[3-[[C-(benzenecarboximidoyloxy)carbonimidoyl]sulfanylmethyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143236031 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-amino-3-[3-[[C-(benzenecarboximidoyloxy)carbonimidoyl]sulfanylmethyl]phenyl]propanoic acid |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccccc1)SCc1cccc(CC(N)C(=O)O)c1 |
| InChI | InChI=1S/C18H19N3O3S/c19-15(17(22)23)10-12-5-4-6-13(9-12)11-25-18(21)24-16(20)14-7-2-1-3-8-14/h1-9,15,20-21H,10-11,19H2,(H,22,23)/b20-16+,21-18+ |
| InChIKey | LOFBGVLVDVMTEB-OBPCBVSQSA-N |
| XLogP | 2.85 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|