C17H20BrNO2 — CID 143239018
3-bromo-N-(2-hydroxyphenyl)-2,5-dimethylbenzamide;ethane (PubChem CID 143239018) has the molecular formula C17H20BrNO2 and a molecular weight of 350.26 g/mol. Its IUPAC name is 3-bromo-N-(2-hydroxyphenyl)-2,5-dimethylbenzamide;ethane.
| Compound Name | 3-bromo-N-(2-hydroxyphenyl)-2,5-dimethylbenzamide;ethane |
|---|---|
| PubChem CID | 143239018 |
| Molecular Formula | C17H20BrNO2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 3-bromo-N-(2-hydroxyphenyl)-2,5-dimethylbenzamide;ethane |
| SMILES | CC.Cc1cc(Br)c(C)c(C(=O)Nc2ccccc2O)c1 |
| InChI | InChI=1S/C15H14BrNO2.C2H6/c1-9-7-11(10(2)12(16)8-9)15(19)17-13-5-3-4-6-14(13)18;1-2/h3-8,18H,1-2H3,(H,17,19);1-2H3 |
| InChIKey | HOAOVOGBFIWYPJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|