C48H42N4 — CID 143239996
(1E,3E,7Z)-4-[3-[6-[3-[4-(methylamino)phenyl]phenyl]-2-phenanthren-9-ylpyrimidin-4-yl]phenyl]cycloocta-1,3,7-trien-1-amine;prop-1-ene (PubChem CID 143239996) has the molecular formula C48H42N4 and a molecular weight of 674.89 g/mol. Its IUPAC name is (1E,3E,7Z)-4-[3-[6-[3-[4-(methylamino)phenyl]phenyl]-2-phenanthren-9-ylpyrimidin-4-yl]phenyl]cycloocta-1,3,7-trien-1-amine;prop-1-ene.
| Compound Name | (1E,3E,7Z)-4-[3-[6-[3-[4-(methylamino)phenyl]phenyl]-2-phenanthren-9-ylpyrimidin-4-yl]phenyl]cycloocta-1,3,7-trien-1-amine;prop-1-ene |
|---|---|
| PubChem CID | 143239996 |
| Molecular Formula | C48H42N4 |
| Molecular Weight | 674.89 g/mol |
| Exact Mass | 674.34 |
| IUPAC Name | (1E,3E,7Z)-4-[3-[6-[3-[4-(methylamino)phenyl]phenyl]-2-phenanthren-9-ylpyrimidin-4-yl]phenyl]cycloocta-1,3,7-trien-1-amine;prop-1-ene |
| SMILES | C=CC.CNc1ccc(-c2cccc(-c3cc(-c4cccc(/C5=C/C=C(N)\C=C/CC5)c4)nc(-c4cc5ccccc5c5ccccc45)n3)c2)cc1 |
| InChI | InChI=1S/C45H36N4.C3H6/c1-47-38-24-21-31(22-25-38)33-13-9-15-36(27-33)44-29-43(35-14-8-12-32(26-35)30-10-2-4-16-37(46)23-20-30)48-45(49-44)42-28-34-11-3-5-17-39(34)40-18-6-7-19-41(40)42;1-3-2/h3-9,11-29,47H,2,10,46H2,1H3;3H,1H2,2H3/b16-4-,30-20+,37-23+; |
| InChIKey | OMBSLCOAEYOXNR-UPGPPJCRSA-N |
| XLogP | 12.26 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.89 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|