C10H17N3 — CID 143241275
(1Z,3E)-3-(4,5-dihydro-1H-imidazol-2-yl)-N,N-dimethylpenta-1,3-dien-1-amine (PubChem CID 143241275) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is (1Z,3E)-3-(4,5-dihydro-1H-imidazol-2-yl)-N,N-dimethylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-3-(4,5-dihydro-1H-imidazol-2-yl)-N,N-dimethylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143241275 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (1Z,3E)-3-(4,5-dihydro-1H-imidazol-2-yl)-N,N-dimethylpenta-1,3-dien-1-amine |
| SMILES | C/C=C(\C=C/N(C)C)C1=NCCN1 |
| InChI | InChI=1S/C10H17N3/c1-4-9(5-8-13(2)3)10-11-6-7-12-10/h4-5,8H,6-7H2,1-3H3,(H,11,12)/b8-5-,9-4+ |
| InChIKey | FODMZMPZKTVYKD-JDNPHIJCSA-N |
| XLogP | 1.01 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|