C17H15ClN4 — CID 143243970
4-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]pyridine-2,3-diamine (PubChem CID 143243970) has the molecular formula C17H15ClN4 and a molecular weight of 310.79 g/mol. Its IUPAC name is 4-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]pyridine-2,3-diamine.
| Compound Name | 4-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 143243970 |
| Molecular Formula | C17H15ClN4 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]pyridine-2,3-diamine |
| SMILES | Nc1nccc(Cc2cccc(-c3ccc(Cl)nc3)c2)c1N |
| InChI | InChI=1S/C17H15ClN4/c18-15-5-4-14(10-22-15)12-3-1-2-11(8-12)9-13-6-7-21-17(20)16(13)19/h1-8,10H,9,19H2,(H2,20,21) |
| InChIKey | FZRZDKWFVSQZTH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|