About azane;3-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine
azane;3-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine (PubChem CID 69247918) has the molecular formula C17H18N4
and a molecular weight of 278.36 g/mol. Its IUPAC name is azane;3-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine.
Molecular Properties
| Compound Name | azane;3-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine |
| PubChem CID | 69247918 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | azane;3-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine |
| SMILES | N.Nc1ncccc1Cc1cccc(-c2cccnc2)c1 |
| InChI | InChI=1S/C17H15N3.H3N/c18-17-15(6-3-9-20-17)11-13-4-1-5-14(10-13)16-7-2-8-19-12-16;/h1-10,12H,11H2,(H2,18,20);1H3 |
| InChIKey | NFNQGQKZHULIOW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;3-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine?
The IUPAC name of azane;3-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine (CID 69247918) is azane;3-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine.
What is the SMILES notation for azane;3-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine?
The canonical SMILES for azane;3-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine is N.Nc1ncccc1Cc1cccc(-c2cccnc2)c1.
What is the InChIKey of azane;3-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine?
The InChIKey is NFNQGQKZHULIOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3.H3N/c18-17-15(6-3-9-20-17)11-13-4-1-5-14(10-13)16-7-2-8-19-12-16;/h1-10,12H,11H2,(H2,18,20);1H3.
What are the key properties of azane;3-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine?
azane;3-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine has a molecular weight of 278.36 g/mol, XLogP of 3.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine is sourced from PubChem (CID 69247918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).